C27H48O2Si — CID 102160303
(1S,3Z,7Z,9R,10S,14S)-14-tert-butyl-9-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethylbicyclo[8.2.2]tetradeca-3,7-dien-11-one (PubChem CID 102160303) has the molecular formula C27H48O2Si and a molecular weight of 432.77 g/mol. Its IUPAC name is (1S,3Z,7Z,9R,10S,14S)-14-tert-butyl-9-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethylbicyclo[8.2.2]tetradeca-3,7-dien-11-one.
| Compound Name | (1S,3Z,7Z,9R,10S,14S)-14-tert-butyl-9-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethylbicyclo[8.2.2]tetradeca-3,7-dien-11-one |
|---|---|
| PubChem CID | 102160303 |
| Molecular Formula | C27H48O2Si |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (1S,3Z,7Z,9R,10S,14S)-14-tert-butyl-9-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethylbicyclo[8.2.2]tetradeca-3,7-dien-11-one |
| SMILES | C/C1=C/C[C@H]2C[C@H](C(C)(C)C)[C@H](C(=O)C2C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C\CC1 |
| InChI | InChI=1S/C27H48O2Si/c1-18-13-12-14-19(2)25(29-30(10,11)27(7,8)9)23-22(26(4,5)6)17-21(16-15-18)20(3)24(23)28/h14-15,20-23,25H,12-13,16-17H2,1-11H3/b18-15-,19-14-/t20?,21-,22-,23+,25-/m0/s1 |
| InChIKey | QOSBZXXHHDQYSX-LAINLCMUSA-N |
| XLogP | 7.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|