About 2,6-bis(difluoromethyl)-8,9-dimethylpurine
2,6-bis(difluoromethyl)-8,9-dimethylpurine (PubChem CID 102160311) has the molecular formula C9H8F4N4
and a molecular weight of 248.18 g/mol. Its IUPAC name is 2,6-bis(difluoromethyl)-8,9-dimethylpurine.
Molecular Properties
| Compound Name | 2,6-bis(difluoromethyl)-8,9-dimethylpurine |
| PubChem CID | 102160311 |
| Molecular Formula | C9H8F4N4 |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2,6-bis(difluoromethyl)-8,9-dimethylpurine |
| SMILES | Cc1nc2c(C(F)F)nc(C(F)F)nc2n1C |
| InChI | InChI=1S/C9H8F4N4/c1-3-14-5-4(6(10)11)15-8(7(12)13)16-9(5)17(3)2/h6-7H,1-2H3 |
| InChIKey | CUIVSHNDSHQLFA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-bis(difluoromethyl)-8,9-dimethylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(difluoromethyl)-8,9-dimethylpurine?
The IUPAC name of 2,6-bis(difluoromethyl)-8,9-dimethylpurine (CID 102160311) is 2,6-bis(difluoromethyl)-8,9-dimethylpurine.
What is the SMILES notation for 2,6-bis(difluoromethyl)-8,9-dimethylpurine?
The canonical SMILES for 2,6-bis(difluoromethyl)-8,9-dimethylpurine is Cc1nc2c(C(F)F)nc(C(F)F)nc2n1C.
What is the InChIKey of 2,6-bis(difluoromethyl)-8,9-dimethylpurine?
The InChIKey is CUIVSHNDSHQLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F4N4/c1-3-14-5-4(6(10)11)15-8(7(12)13)16-9(5)17(3)2/h6-7H,1-2H3.
What are the key properties of 2,6-bis(difluoromethyl)-8,9-dimethylpurine?
2,6-bis(difluoromethyl)-8,9-dimethylpurine has a molecular weight of 248.18 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(difluoromethyl)-8,9-dimethylpurine is sourced from PubChem (CID 102160311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).