C18H18ClF4NO2 — CID 10216036
2-[4-[(2-chloro-4-pyridinyl)methyl]-5,5,5-trifluoro-4-hydroxy-2-methylpentan-2-yl]-4-fluorophenol (PubChem CID 10216036) has the molecular formula C18H18ClF4NO2 and a molecular weight of 391.79 g/mol. Its IUPAC name is 2-[4-[(2-chloro-4-pyridinyl)methyl]-5,5,5-trifluoro-4-hydroxy-2-methylpentan-2-yl]-4-fluorophenol.
| Compound Name | 2-[4-[(2-chloro-4-pyridinyl)methyl]-5,5,5-trifluoro-4-hydroxy-2-methylpentan-2-yl]-4-fluorophenol |
|---|---|
| PubChem CID | 10216036 |
| Molecular Formula | C18H18ClF4NO2 |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[4-[(2-chloro-4-pyridinyl)methyl]-5,5,5-trifluoro-4-hydroxy-2-methylpentan-2-yl]-4-fluorophenol |
| SMILES | CC(C)(CC(O)(Cc1ccnc(Cl)c1)C(F)(F)F)c1cc(F)ccc1O |
| InChI | InChI=1S/C18H18ClF4NO2/c1-16(2,13-8-12(20)3-4-14(13)25)10-17(26,18(21,22)23)9-11-5-6-24-15(19)7-11/h3-8,25-26H,9-10H2,1-2H3 |
| InChIKey | JHVUZNHBPRRJBX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|