C55H56F6N2S2 — CID 102160454
3,6-ditert-butyl-9-[4-[2-[5-(3,6-ditert-butylcarbazol-9-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]carbazole (PubChem CID 102160454) has the molecular formula C55H56F6N2S2 and a molecular weight of 923.19 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-[2-[5-(3,6-ditert-butylcarbazol-9-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-[2-[5-(3,6-ditert-butylcarbazol-9-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 102160454 |
| Molecular Formula | C55H56F6N2S2 |
| Molecular Weight | 923.19 g/mol |
| Exact Mass | 922.38 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-[2-[5-(3,6-ditert-butylcarbazol-9-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]carbazole |
| SMILES | Cc1sc(-n2c3ccc(C(C)(C)C)cc3c3cc(C(C)(C)C)ccc32)cc1C1=C(c2cc(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C55H56F6N2S2/c1-29-35(27-45(64-29)62-41-19-15-31(49(3,4)5)23-37(41)38-24-32(50(6,7)8)16-20-42(38)62)47-48(54(58,59)55(60,61)53(47,56)57)36-28-46(65-30(36)2)63-43-21-17-33(51(9,10)11)25-39(43)40-26-34(52(12,13)14)18-22-44(40)63/h15-28H,1-14H3 |
| InChIKey | SOGBCOCAIYBVKP-UHFFFAOYSA-N |
| XLogP | 17.64 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.19 |
| LogP ≤ 5 | 17.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|