About 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one
2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one (PubChem CID 10216071) has the molecular formula C27H26N2O
and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one.
Molecular Properties
| Compound Name | 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one |
| PubChem CID | 10216071 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one |
| SMILES | O=c1[nH]c2ccc(CCCN3CC=C(c4ccccc4)CC3)cc2c2ccccc12 |
| InChI | InChI=1S/C27H26N2O/c30-27-24-11-5-4-10-23(24)25-19-20(12-13-26(25)28-27)7-6-16-29-17-14-22(15-18-29)21-8-2-1-3-9-21/h1-5,8-14,19H,6-7,15-18H2,(H,28,30) |
| InChIKey | ANKUJWLWOYNWFQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one?
The IUPAC name of 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one (CID 10216071) is 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one.
What is the SMILES notation for 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one?
The canonical SMILES for 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one is O=c1[nH]c2ccc(CCCN3CC=C(c4ccccc4)CC3)cc2c2ccccc12.
What is the InChIKey of 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one?
The InChIKey is ANKUJWLWOYNWFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O/c30-27-24-11-5-4-10-23(24)25-19-20(12-13-26(25)28-27)7-6-16-29-17-14-22(15-18-29)21-8-2-1-3-9-21/h1-5,8-14,19H,6-7,15-18H2,(H,28,30).
What are the key properties of 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one?
2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one has a molecular weight of 394.52 g/mol, XLogP of 5.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-5H-phenanthridin-6-one is sourced from PubChem (CID 10216071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).