C17H21NO3 — CID 102160928
(2R,3S,5R,6S)-3,5-dimethyl-2,6-bis(5-methylfuran-2-yl)piperidin-4-one (PubChem CID 102160928) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2R,3S,5R,6S)-3,5-dimethyl-2,6-bis(5-methylfuran-2-yl)piperidin-4-one.
| Compound Name | (2R,3S,5R,6S)-3,5-dimethyl-2,6-bis(5-methylfuran-2-yl)piperidin-4-one |
|---|---|
| PubChem CID | 102160928 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2R,3S,5R,6S)-3,5-dimethyl-2,6-bis(5-methylfuran-2-yl)piperidin-4-one |
| SMILES | Cc1ccc([C@H]2N[C@@H](c3ccc(C)o3)[C@H](C)C(=O)[C@@H]2C)o1 |
| InChI | InChI=1S/C17H21NO3/c1-9-5-7-13(20-9)15-11(3)17(19)12(4)16(18-15)14-8-6-10(2)21-14/h5-8,11-12,15-16,18H,1-4H3/t11-,12+,15+,16- |
| InChIKey | NXCMBXTVSWNRJC-CRJCFHLZSA-N |
| XLogP | 3.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |