C15H19NO2 — CID 102160934
(2S,3S,5S,6R)-2,6-bis(furan-2-yl)-3,5-dimethylpiperidine (PubChem CID 102160934) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2S,3S,5S,6R)-2,6-bis(furan-2-yl)-3,5-dimethylpiperidine.
| Compound Name | (2S,3S,5S,6R)-2,6-bis(furan-2-yl)-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 102160934 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (2S,3S,5S,6R)-2,6-bis(furan-2-yl)-3,5-dimethylpiperidine |
| SMILES | C[C@H]1C[C@H](C)[C@H](c2ccco2)N[C@@H]1c1ccco1 |
| InChI | InChI=1S/C15H19NO2/c1-10-9-11(2)15(13-6-4-8-18-13)16-14(10)12-5-3-7-17-12/h3-8,10-11,14-16H,9H2,1-2H3/t10-,11-,14-,15+/m0/s1 |
| InChIKey | AAQQOJGZLUPYMM-LWWSYDQCSA-N |
| XLogP | 3.92 |
| TPSA | 38.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |