C15H32N6 — CID 102161000
11-methyl-1,4,8,10,13,15-hexazatricyclo[13.3.1.14,8]icosane (PubChem CID 102161000) has the molecular formula C15H32N6 and a molecular weight of 296.46 g/mol. Its IUPAC name is 11-methyl-1,4,8,10,13,15-hexazatricyclo[13.3.1.14,8]icosane.
| Compound Name | 11-methyl-1,4,8,10,13,15-hexazatricyclo[13.3.1.14,8]icosane |
|---|---|
| PubChem CID | 102161000 |
| Molecular Formula | C15H32N6 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | 11-methyl-1,4,8,10,13,15-hexazatricyclo[13.3.1.14,8]icosane |
| SMILES | CC1CNCN2CCCN(CCN3CCCN(CN1)C3)C2 |
| InChI | InChI=1S/C15H32N6/c1-15-10-16-11-20-6-2-4-18(13-20)8-9-19-5-3-7-21(14-19)12-17-15/h15-17H,2-14H2,1H3 |
| InChIKey | FUJWFPPCCIGWRI-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 37.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |