C20H23Cl6N3O6 — CID 102161143
tert-butyl 1-[2,2,2-trichloroethoxycarbonyl-(2,2,2-trichloroethoxycarbonylamino)amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 102161143) has the molecular formula C20H23Cl6N3O6 and a molecular weight of 614.14 g/mol. Its IUPAC name is tert-butyl 1-[2,2,2-trichloroethoxycarbonyl-(2,2,2-trichloroethoxycarbonylamino)amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 1-[2,2,2-trichloroethoxycarbonyl-(2,2,2-trichloroethoxycarbonylamino)amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 102161143 |
| Molecular Formula | C20H23Cl6N3O6 |
| Molecular Weight | 614.14 g/mol |
| Exact Mass | 610.97 |
| IUPAC Name | tert-butyl 1-[2,2,2-trichloroethoxycarbonyl-(2,2,2-trichloroethoxycarbonylamino)amino]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccccc2C1N(NC(=O)OCC(Cl)(Cl)Cl)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C20H23Cl6N3O6/c1-18(2,3)35-16(31)28-9-8-12-6-4-5-7-13(12)14(28)29(17(32)34-11-20(24,25)26)27-15(30)33-10-19(21,22)23/h4-7,14H,8-11H2,1-3H3,(H,27,30) |
| InChIKey | ZOOPGWUIMVHEFW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.14 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|