C14H24O5 — CID 102161308
(3S,4R,5R)-4-[[(2R,3S,4R,5R)-4-(hydroxymethyl)-3,5-dimethyloxolan-2-yl]oxymethyl]-3,5-dimethyloxolan-2-one (PubChem CID 102161308) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (3S,4R,5R)-4-[[(2R,3S,4R,5R)-4-(hydroxymethyl)-3,5-dimethyloxolan-2-yl]oxymethyl]-3,5-dimethyloxolan-2-one.
| Compound Name | (3S,4R,5R)-4-[[(2R,3S,4R,5R)-4-(hydroxymethyl)-3,5-dimethyloxolan-2-yl]oxymethyl]-3,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 102161308 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (3S,4R,5R)-4-[[(2R,3S,4R,5R)-4-(hydroxymethyl)-3,5-dimethyloxolan-2-yl]oxymethyl]-3,5-dimethyloxolan-2-one |
| SMILES | C[C@@H]1[C@H](OC[C@H]2[C@H](C)C(=O)O[C@@H]2C)O[C@H](C)[C@H]1CO |
| InChI | InChI=1S/C14H24O5/c1-7-12(10(4)18-13(7)16)6-17-14-8(2)11(5-15)9(3)19-14/h7-12,14-15H,5-6H2,1-4H3/t7-,8-,9+,10+,11-,12-,14+/m0/s1 |
| InChIKey | GGZMQQUHNRCSRE-QJUBZYJZSA-N |
| XLogP | 1.19 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |