About CID 102161336
CID 102161336 (PubChem CID 102161336) has the molecular formula C84H62N4O12
and a molecular weight of 1319.44 g/mol.
Molecular Properties
| Compound Name | CID 102161336 |
| PubChem CID | 102161336 |
| Molecular Formula | C84H62N4O12 |
| Molecular Weight | 1319.44 g/mol |
| Exact Mass | 1318.44 |
| IUPAC Name | — |
| SMILES | CC1c2cc3c4c5c2OCOc2c1cc1c6c2COc2ccccc2-c2c7nc(c8c9ccc([nH]9)c(c9nc(c(c%10ccc2[nH]%10)-c2ccccc2OC5)C=C9)-c2ccccc2OCc2c(c(cc5c2OCOc2c(cc(c(c2COc2ccccc2-8)OCO6)C1C)C5C)C3C)OCO4)C=C7 |
| InChI | InChI=1S/C84H62N4O12/c1-41-49-29-51-42(2)53-31-55-44(4)56-32-54-43(3)52-30-50(41)78-58-34-90-70-18-10-6-14-46(70)74-62-22-21-61(85-62)73-45-13-5-9-17-69(45)89-33-57(77(49)93-37-94-78)79(51)95-38-97-81(53)59-35-91-71-19-11-7-15-47(71)75(65-25-23-63(73)86-65)67-27-28-68(88-67)76(66-26-24-64(74)87-66)48-16-8-12-20-72(48)92-36-60(82(54)98-39-96-80(52)58)84(56)100-40-99-83(55)59/h5-32,41-44,85,88H,33-40H2,1-4H3/b73-61-,73-63-,74-62+,74-64-,75-65+,75-67-,76-66+,76-68+ |
| InChIKey | GYIHUGOXZPGSNV-WBZHAZEUSA-N |
| XLogP | 18.42 |
| TPSA | 168.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 100 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1319.44 |
| LogP ≤ 5 | 18.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
Analyze CID 102161336 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102161336?
The IUPAC name of CID 102161336 (CID 102161336) is not available.
What is the SMILES notation for CID 102161336?
The canonical SMILES for CID 102161336 is CC1c2cc3c4c5c2OCOc2c1cc1c6c2COc2ccccc2-c2c7nc(c8c9ccc([nH]9)c(c9nc(c(c%10ccc2[nH]%10)-c2ccccc2OC5)C=C9)-c2ccccc2OCc2c(c(cc5c2OCOc2c(cc(c(c2COc2ccccc2-8)OCO6)C1C)C5C)C3C)OCO4)C=C7.
What is the InChIKey of CID 102161336?
The InChIKey is GYIHUGOXZPGSNV-WBZHAZEUSA-N. The full InChI is InChI=1S/C84H62N4O12/c1-41-49-29-51-42(2)53-31-55-44(4)56-32-54-43(3)52-30-50(41)78-58-34-90-70-18-10-6-14-46(70)74-62-22-21-61(85-62)73-45-13-5-9-17-69(45)89-33-57(77(49)93-37-94-78)79(51)95-38-97-81(53)59-35-91-71-19-11-7-15-47(71)75(65-25-23-63(73)86-65)67-27-28-68(88-67)76(66-26-24-64(74)87-66)48-16-8-12-20-72(48)92-36-60(82(54)98-39-96-80(52)58)84(56)100-40-99-83(55)59/h5-32,41-44,85,88H,33-40H2,1-4H3/b73-61-,73-63-,74-62+,74-64-,75-65+,75-67-,76-66+,76-68+.
What are the key properties of CID 102161336?
CID 102161336 has a molecular weight of 1319.44 g/mol, XLogP of 18.42, 0 rotatable bonds, 2 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102161336 is sourced from PubChem (CID 102161336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).