About (2S,3S)-2,3-difluorooxetane
(2S,3S)-2,3-difluorooxetane (PubChem CID 102161856) has the molecular formula C3H4F2O
and a molecular weight of 94.06 g/mol. Its IUPAC name is (2S,3S)-2,3-difluorooxetane.
Molecular Properties
| Compound Name | (2S,3S)-2,3-difluorooxetane |
| PubChem CID | 102161856 |
| Molecular Formula | C3H4F2O |
| Molecular Weight | 94.06 g/mol |
| Exact Mass | 94.02 |
| IUPAC Name | (2S,3S)-2,3-difluorooxetane |
| SMILES | F[C@@H]1OC[C@@H]1F |
| InChI | InChI=1S/C3H4F2O/c4-2-1-6-3(2)5/h2-3H,1H2/t2-,3+/m0/s1 |
| InChIKey | YNUONZJBZZBSKT-STHAYSLISA-N |
| XLogP | 0.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.06 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,3S)-2,3-difluorooxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2,3-difluorooxetane?
The IUPAC name of (2S,3S)-2,3-difluorooxetane (CID 102161856) is (2S,3S)-2,3-difluorooxetane.
What is the SMILES notation for (2S,3S)-2,3-difluorooxetane?
The canonical SMILES for (2S,3S)-2,3-difluorooxetane is F[C@@H]1OC[C@@H]1F.
What is the InChIKey of (2S,3S)-2,3-difluorooxetane?
The InChIKey is YNUONZJBZZBSKT-STHAYSLISA-N. The full InChI is InChI=1S/C3H4F2O/c4-2-1-6-3(2)5/h2-3H,1H2/t2-,3+/m0/s1.
What are the key properties of (2S,3S)-2,3-difluorooxetane?
(2S,3S)-2,3-difluorooxetane has a molecular weight of 94.06 g/mol, XLogP of 0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,3-difluorooxetane is sourced from PubChem (CID 102161856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).