C12H17N — CID 102162097
(1R)-1,2,7-trimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 102162097) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is (1R)-1,2,7-trimethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1R)-1,2,7-trimethyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 102162097 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (1R)-1,2,7-trimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1ccc2c(c1)[C@@H](C)N(C)CC2 |
| InChI | InChI=1S/C12H17N/c1-9-4-5-11-6-7-13(3)10(2)12(11)8-9/h4-5,8,10H,6-7H2,1-3H3/t10-/m1/s1 |
| InChIKey | QNUBMIAZHBADNZ-SNVBAGLBSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |