C20H22F3N5O — CID 10216231
(2S)-N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-(4-pyrimidin-2-ylphenyl)ethyl]amino]pentanamide (PubChem CID 10216231) has the molecular formula C20H22F3N5O and a molecular weight of 405.42 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-(4-pyrimidin-2-ylphenyl)ethyl]amino]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-(4-pyrimidin-2-ylphenyl)ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 10216231 |
| Molecular Formula | C20H22F3N5O |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-(4-pyrimidin-2-ylphenyl)ethyl]amino]pentanamide |
| SMILES | CC(C)C[C@H](N[C@@H](c1ccc(-c2ncccn2)cc1)C(F)(F)F)C(=O)NCC#N |
| InChI | InChI=1S/C20H22F3N5O/c1-13(2)12-16(19(29)27-11-8-24)28-17(20(21,22)23)14-4-6-15(7-5-14)18-25-9-3-10-26-18/h3-7,9-10,13,16-17,28H,11-12H2,1-2H3,(H,27,29)/t16-,17-/m0/s1 |
| InChIKey | JIAJPIQRIJHHAB-IRXDYDNUSA-N |
| XLogP | 3.39 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|