C12H18N2 — CID 102162386
4-cyclohexyl-2,6-dimethylpyrimidine (PubChem CID 102162386) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-cyclohexyl-2,6-dimethylpyrimidine.
| Compound Name | 4-cyclohexyl-2,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 102162386 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-cyclohexyl-2,6-dimethylpyrimidine |
| SMILES | Cc1cc(C2CCCCC2)nc(C)n1 |
| InChI | InChI=1S/C12H18N2/c1-9-8-12(14-10(2)13-9)11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3 |
| InChIKey | VTVXFVLXERUXPL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |