C21H20ClN7 — CID 10216239
7-(2-chloro-4-pyridinyl)-8-(3-methylphenyl)-5-piperazin-1-yl-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 10216239) has the molecular formula C21H20ClN7 and a molecular weight of 405.89 g/mol. Its IUPAC name is 7-(2-chloro-4-pyridinyl)-8-(3-methylphenyl)-5-piperazin-1-yl-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 7-(2-chloro-4-pyridinyl)-8-(3-methylphenyl)-5-piperazin-1-yl-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 10216239 |
| Molecular Formula | C21H20ClN7 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 7-(2-chloro-4-pyridinyl)-8-(3-methylphenyl)-5-piperazin-1-yl-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | Cc1cccc(-c2c(-c3ccnc(Cl)c3)nc(N3CCNCC3)n3cnnc23)c1 |
| InChI | InChI=1S/C21H20ClN7/c1-14-3-2-4-15(11-14)18-19(16-5-6-24-17(22)12-16)26-21(28-9-7-23-8-10-28)29-13-25-27-20(18)29/h2-6,11-13,23H,7-10H2,1H3 |
| InChIKey | UGFHARBCEIGSRG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|