C21H21N5O2S — CID 10216257
4-[3-[(6,7-diethoxyquinazolin-4-yl)amino]phenyl]-1,3-thiazol-2-amine (PubChem CID 10216257) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is 4-[3-[(6,7-diethoxyquinazolin-4-yl)amino]phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3-[(6,7-diethoxyquinazolin-4-yl)amino]phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 10216257 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-[3-[(6,7-diethoxyquinazolin-4-yl)amino]phenyl]-1,3-thiazol-2-amine |
| SMILES | CCOc1cc2ncnc(Nc3cccc(-c4csc(N)n4)c3)c2cc1OCC |
| InChI | InChI=1S/C21H21N5O2S/c1-3-27-18-9-15-16(10-19(18)28-4-2)23-12-24-20(15)25-14-7-5-6-13(8-14)17-11-29-21(22)26-17/h5-12H,3-4H2,1-2H3,(H2,22,26)(H,23,24,25) |
| InChIKey | GOHZFDZYDZGWHC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |