About [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium
[(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium (PubChem CID 102162634) has the molecular formula C7H14NO+
and a molecular weight of 128.19 g/mol. Its IUPAC name is [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium.
Molecular Properties
| Compound Name | [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium |
| PubChem CID | 102162634 |
| Molecular Formula | C7H14NO+ |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium |
| SMILES | C=[NH+][C@@H](C)[C@H](C)/C=C/O |
| InChI | InChI=1S/C7H13NO/c1-6(4-5-9)7(2)8-3/h4-7,9H,3H2,1-2H3/p+1/b5-4+/t6-,7+/m1/s1 |
| InChIKey | WZAPGTVFEPJZDY-ZVCMNORXSA-O |
| XLogP | -0.14 |
| TPSA | 34.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium?
The IUPAC name of [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium (CID 102162634) is [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium.
What is the SMILES notation for [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium?
The canonical SMILES for [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium is C=[NH+][C@@H](C)[C@H](C)/C=C/O.
What is the InChIKey of [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium?
The InChIKey is WZAPGTVFEPJZDY-ZVCMNORXSA-O. The full InChI is InChI=1S/C7H13NO/c1-6(4-5-9)7(2)8-3/h4-7,9H,3H2,1-2H3/p+1/b5-4+/t6-,7+/m1/s1.
What are the key properties of [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium?
[(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium has a molecular weight of 128.19 g/mol, XLogP of -0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2S,3R)-5-hydroxy-3-methylpent-4-en-2-yl]-methylideneazanium is sourced from PubChem (CID 102162634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).