C16H13O2P — CID 102162733
naphthalen-2-yl(phenyl)phosphinic acid (PubChem CID 102162733) has the molecular formula C16H13O2P and a molecular weight of 268.25 g/mol. Its IUPAC name is naphthalen-2-yl(phenyl)phosphinic acid.
| Compound Name | naphthalen-2-yl(phenyl)phosphinic acid |
|---|---|
| PubChem CID | 102162733 |
| Molecular Formula | C16H13O2P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | naphthalen-2-yl(phenyl)phosphinic acid |
| SMILES | O=P(O)(c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H13O2P/c17-19(18,15-8-2-1-3-9-15)16-11-10-13-6-4-5-7-14(13)12-16/h1-12H,(H,17,18) |
| InChIKey | LQMCFAYQKJDLJE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|