C10H10N4S — CID 102162761
3-amino-5-pyrrolidin-1-ylthiophene-2,4-dicarbonitrile (PubChem CID 102162761) has the molecular formula C10H10N4S and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-amino-5-pyrrolidin-1-ylthiophene-2,4-dicarbonitrile.
| Compound Name | 3-amino-5-pyrrolidin-1-ylthiophene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 102162761 |
| Molecular Formula | C10H10N4S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3-amino-5-pyrrolidin-1-ylthiophene-2,4-dicarbonitrile |
| SMILES | N#Cc1sc(N2CCCC2)c(C#N)c1N |
| InChI | InChI=1S/C10H10N4S/c11-5-7-9(13)8(6-12)15-10(7)14-3-1-2-4-14/h1-4,13H2 |
| InChIKey | QKJUVIPXCHCHSA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |