C7H6O4 — CID 102162800
(3aR,6aS)-4-methylidene-3a,6a-dihydro-3H-furo[2,3-b]furan-2,5-dione (PubChem CID 102162800) has the molecular formula C7H6O4 and a molecular weight of 154.12 g/mol. Its IUPAC name is (3aR,6aS)-4-methylidene-3a,6a-dihydro-3H-furo[2,3-b]furan-2,5-dione.
| Compound Name | (3aR,6aS)-4-methylidene-3a,6a-dihydro-3H-furo[2,3-b]furan-2,5-dione |
|---|---|
| PubChem CID | 102162800 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | (3aR,6aS)-4-methylidene-3a,6a-dihydro-3H-furo[2,3-b]furan-2,5-dione |
| SMILES | C=C1C(=O)O[C@@H]2OC(=O)C[C@H]12 |
| InChI | InChI=1S/C7H6O4/c1-3-4-2-5(8)10-7(4)11-6(3)9/h4,7H,1-2H2/t4-,7+/m1/s1 |
| InChIKey | PFXADELMYNKQLQ-FBCQKBJTSA-N |
| XLogP | -0.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|