C16H16O5 — CID 102162902
2,2-dimethyl-5-[(4S)-3-methylidene-4H-chromen-4-yl]-1,3-dioxane-4,6-dione (PubChem CID 102162902) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(4S)-3-methylidene-4H-chromen-4-yl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(4S)-3-methylidene-4H-chromen-4-yl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 102162902 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2,2-dimethyl-5-[(4S)-3-methylidene-4H-chromen-4-yl]-1,3-dioxane-4,6-dione |
| SMILES | C=C1COc2ccccc2[C@H]1C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C16H16O5/c1-9-8-19-11-7-5-4-6-10(11)12(9)13-14(17)20-16(2,3)21-15(13)18/h4-7,12-13H,1,8H2,2-3H3/t12-/m0/s1 |
| InChIKey | NHRUJJAHJDVADE-LBPRGKRZSA-N |
| XLogP | 2.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|