About 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol
2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol (PubChem CID 102162999) has the molecular formula C25H19ClO2
and a molecular weight of 386.88 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol |
| PubChem CID | 102162999 |
| Molecular Formula | C25H19ClO2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol |
| SMILES | OCCOC(C#Cc1ccccc1)(C#Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClO2/c26-24-13-11-23(12-14-24)25(28-20-19-27,17-15-21-7-3-1-4-8-21)18-16-22-9-5-2-6-10-22/h1-14,27H,19-20H2 |
| InChIKey | NZGFQDVHLKMFIU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol?
The IUPAC name of 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol (CID 102162999) is 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol.
What is the SMILES notation for 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol?
The canonical SMILES for 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol is OCCOC(C#Cc1ccccc1)(C#Cc1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol?
The InChIKey is NZGFQDVHLKMFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19ClO2/c26-24-13-11-23(12-14-24)25(28-20-19-27,17-15-21-7-3-1-4-8-21)18-16-22-9-5-2-6-10-22/h1-14,27H,19-20H2.
What are the key properties of 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol?
2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol has a molecular weight of 386.88 g/mol, XLogP of 4.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-chlorophenyl)-1,5-diphenylpenta-1,4-diyn-3-yl]oxyethanol is sourced from PubChem (CID 102162999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).