C11H19ClSi2 — CID 102163014
(3-chloro-5-trimethylsilylpenta-1,4-diynyl)-trimethylsilane (PubChem CID 102163014) has the molecular formula C11H19ClSi2 and a molecular weight of 242.90 g/mol. Its IUPAC name is (3-chloro-5-trimethylsilylpenta-1,4-diynyl)-trimethylsilane.
| Compound Name | (3-chloro-5-trimethylsilylpenta-1,4-diynyl)-trimethylsilane |
|---|---|
| PubChem CID | 102163014 |
| Molecular Formula | C11H19ClSi2 |
| Molecular Weight | 242.90 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (3-chloro-5-trimethylsilylpenta-1,4-diynyl)-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC(Cl)C#C[Si](C)(C)C |
| InChI | InChI=1S/C11H19ClSi2/c1-13(2,3)9-7-11(12)8-10-14(4,5)6/h11H,1-6H3 |
| InChIKey | LCUCHIGHCBEOKN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.90 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|