C15H30O4Si — CID 102163304
(3R,4R,5S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethyl-4-hydroxy-3-methyloxan-2-one (PubChem CID 102163304) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is (3R,4R,5S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethyl-4-hydroxy-3-methyloxan-2-one.
| Compound Name | (3R,4R,5S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethyl-4-hydroxy-3-methyloxan-2-one |
|---|---|
| PubChem CID | 102163304 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (3R,4R,5S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethyl-4-hydroxy-3-methyloxan-2-one |
| SMILES | CC[C@H]1COC(=O)[C@](C)(CO[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C15H30O4Si/c1-8-11-9-18-13(17)15(5,12(11)16)10-19-20(6,7)14(2,3)4/h11-12,16H,8-10H2,1-7H3/t11-,12+,15+/m0/s1 |
| InChIKey | BDCMCBGICYGBSF-YWPYICTPSA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|