C20H19F3O4 — CID 102163390
4-ethoxy-2,2-diphenoxy-6-(trifluoromethyl)-3,4-dihydropyran (PubChem CID 102163390) has the molecular formula C20H19F3O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is 4-ethoxy-2,2-diphenoxy-6-(trifluoromethyl)-3,4-dihydropyran.
| Compound Name | 4-ethoxy-2,2-diphenoxy-6-(trifluoromethyl)-3,4-dihydropyran |
|---|---|
| PubChem CID | 102163390 |
| Molecular Formula | C20H19F3O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-ethoxy-2,2-diphenoxy-6-(trifluoromethyl)-3,4-dihydropyran |
| SMILES | CCOC1C=C(C(F)(F)F)OC(Oc2ccccc2)(Oc2ccccc2)C1 |
| InChI | InChI=1S/C20H19F3O4/c1-2-24-17-13-18(20(21,22)23)27-19(14-17,25-15-9-5-3-6-10-15)26-16-11-7-4-8-12-16/h3-13,17H,2,14H2,1H3 |
| InChIKey | BBRVFHPZCVEIOH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|