C17H22O3 — CID 102163404
[(1R,6S,13S)-16-oxatetracyclo[11.2.1.01,6.08,13]hexadeca-7,14-dien-6-yl] acetate (PubChem CID 102163404) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(1R,6S,13S)-16-oxatetracyclo[11.2.1.01,6.08,13]hexadeca-7,14-dien-6-yl] acetate.
| Compound Name | [(1R,6S,13S)-16-oxatetracyclo[11.2.1.01,6.08,13]hexadeca-7,14-dien-6-yl] acetate |
|---|---|
| PubChem CID | 102163404 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(1R,6S,13S)-16-oxatetracyclo[11.2.1.01,6.08,13]hexadeca-7,14-dien-6-yl] acetate |
| SMILES | CC(=O)O[C@@]12C=C3CCCC[C@]34C=C[C@@]1(CCCC2)O4 |
| InChI | InChI=1S/C17H22O3/c1-13(18)19-17-9-5-4-8-16(17)11-10-15(20-16)7-3-2-6-14(15)12-17/h10-12H,2-9H2,1H3/t15-,16+,17-/m0/s1 |
| InChIKey | ZXSKRHJKGKEFMX-BBWFWOEESA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|