About N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide
N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide (PubChem CID 10216436) has the molecular formula C25H27N3O3
and a molecular weight of 417.51 g/mol. Its IUPAC name is N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide |
| PubChem CID | 10216436 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide |
| SMILES | COc1ccc(-c2ncc(C(=O)NC3CCCCC3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O3/c1-30-20-12-8-17(9-13-20)23-24(18-10-14-21(31-2)15-11-18)28-22(16-26-23)25(29)27-19-6-4-3-5-7-19/h8-16,19H,3-7H2,1-2H3,(H,27,29) |
| InChIKey | HOAIFTWDCHXJRY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide?
The IUPAC name of N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide (CID 10216436) is N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide.
What is the SMILES notation for N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide?
The canonical SMILES for N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide is COc1ccc(-c2ncc(C(=O)NC3CCCCC3)nc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide?
The InChIKey is HOAIFTWDCHXJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O3/c1-30-20-12-8-17(9-13-20)23-24(18-10-14-21(31-2)15-11-18)28-22(16-26-23)25(29)27-19-6-4-3-5-7-19/h8-16,19H,3-7H2,1-2H3,(H,27,29).
What are the key properties of N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide?
N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide has a molecular weight of 417.51 g/mol, XLogP of 4.89, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-5,6-bis(4-methoxyphenyl)pyrazine-2-carboxamide is sourced from PubChem (CID 10216436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).