C16H14NNaO3 — CID 102165034
sodium 4-[[(E)-4-cyclopenta-1,3-dien-1-yl-4-oxobut-2-en-2-yl]amino]benzoate (PubChem CID 102165034) has the molecular formula C16H14NNaO3 and a molecular weight of 291.28 g/mol. Its IUPAC name is sodium 4-[[(E)-4-cyclopenta-1,3-dien-1-yl-4-oxobut-2-en-2-yl]amino]benzoate.
| Compound Name | sodium 4-[[(E)-4-cyclopenta-1,3-dien-1-yl-4-oxobut-2-en-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 102165034 |
| Molecular Formula | C16H14NNaO3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | sodium 4-[[(E)-4-cyclopenta-1,3-dien-1-yl-4-oxobut-2-en-2-yl]amino]benzoate |
| SMILES | C/C(=C\C(=O)C1=CC=CC1)Nc1ccc(C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C16H15NO3.Na/c1-11(10-15(18)12-4-2-3-5-12)17-14-8-6-13(7-9-14)16(19)20;/h2-4,6-10,17H,5H2,1H3,(H,19,20);/q;+1/p-1/b11-10+; |
| InChIKey | WDNJBXKCHLARNQ-ASTDGNLGSA-M |
| XLogP | -1.17 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|