C16H21NO2Si — CID 102165151
(5S,6aR)-5-hydroxy-10-trimethylsilyl-6,6a,7,8-tetrahydro-5H-benzo[h]isoquinolin-9-one (PubChem CID 102165151) has the molecular formula C16H21NO2Si and a molecular weight of 287.43 g/mol. Its IUPAC name is (5S,6aR)-5-hydroxy-10-trimethylsilyl-6,6a,7,8-tetrahydro-5H-benzo[h]isoquinolin-9-one.
| Compound Name | (5S,6aR)-5-hydroxy-10-trimethylsilyl-6,6a,7,8-tetrahydro-5H-benzo[h]isoquinolin-9-one |
|---|---|
| PubChem CID | 102165151 |
| Molecular Formula | C16H21NO2Si |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (5S,6aR)-5-hydroxy-10-trimethylsilyl-6,6a,7,8-tetrahydro-5H-benzo[h]isoquinolin-9-one |
| SMILES | C[Si](C)(C)C1=C2c3cnccc3[C@@H](O)C[C@H]2CCC1=O |
| InChI | InChI=1S/C16H21NO2Si/c1-20(2,3)16-13(18)5-4-10-8-14(19)11-6-7-17-9-12(11)15(10)16/h6-7,9-10,14,19H,4-5,8H2,1-3H3/t10-,14+/m1/s1 |
| InChIKey | VCJVLOBCMHTKDJ-YGRLFVJLSA-N |
| XLogP | 3.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|