C19H31NO — CID 102165172
4-(1,3-dicyclohexylprop-2-ynyl)morpholine (PubChem CID 102165172) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 4-(1,3-dicyclohexylprop-2-ynyl)morpholine.
| Compound Name | 4-(1,3-dicyclohexylprop-2-ynyl)morpholine |
|---|---|
| PubChem CID | 102165172 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 4-(1,3-dicyclohexylprop-2-ynyl)morpholine |
| SMILES | C(#CC(C1CCCCC1)N1CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H31NO/c1-3-7-17(8-4-1)11-12-19(18-9-5-2-6-10-18)20-13-15-21-16-14-20/h17-19H,1-10,13-16H2 |
| InChIKey | HGNTUHUREJHBQZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|