C8H17NO3 — CID 102165177
(4R,5R,6S)-5-amino-6-(hydroxymethyl)-2,2-dimethyloxan-4-ol (PubChem CID 102165177) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (4R,5R,6S)-5-amino-6-(hydroxymethyl)-2,2-dimethyloxan-4-ol.
| Compound Name | (4R,5R,6S)-5-amino-6-(hydroxymethyl)-2,2-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 102165177 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (4R,5R,6S)-5-amino-6-(hydroxymethyl)-2,2-dimethyloxan-4-ol |
| SMILES | CC1(C)C[C@@H](O)[C@@H](N)[C@@H](CO)O1 |
| InChI | InChI=1S/C8H17NO3/c1-8(2)3-5(11)7(9)6(4-10)12-8/h5-7,10-11H,3-4,9H2,1-2H3/t5-,6-,7-/m1/s1 |
| InChIKey | ZNRQXCXYZWDSDN-FSDSQADBSA-N |
| XLogP | -0.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |