C14H22O4 — CID 102165542
(3R,3aS,4S,4'S,7aR)-3,4'-dihydroxy-7a-methylspiro[2,3,3a,5,6,7-hexahydro-1H-indene-4,3'-oxane]-2'-one (PubChem CID 102165542) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (3R,3aS,4S,4'S,7aR)-3,4'-dihydroxy-7a-methylspiro[2,3,3a,5,6,7-hexahydro-1H-indene-4,3'-oxane]-2'-one.
| Compound Name | (3R,3aS,4S,4'S,7aR)-3,4'-dihydroxy-7a-methylspiro[2,3,3a,5,6,7-hexahydro-1H-indene-4,3'-oxane]-2'-one |
|---|---|
| PubChem CID | 102165542 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (3R,3aS,4S,4'S,7aR)-3,4'-dihydroxy-7a-methylspiro[2,3,3a,5,6,7-hexahydro-1H-indene-4,3'-oxane]-2'-one |
| SMILES | C[C@]12CCC[C@]3(C(=O)OCC[C@@H]3O)[C@H]1[C@H](O)CC2 |
| InChI | InChI=1S/C14H22O4/c1-13-5-2-6-14(11(13)9(15)3-7-13)10(16)4-8-18-12(14)17/h9-11,15-16H,2-8H2,1H3/t9-,10+,11+,13-,14-/m1/s1 |
| InChIKey | SRZWHLJRMKWTKB-CAFXUDQZSA-N |
| XLogP | 1.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |