C14H21NO3S2 — CID 102165634
2-[methoxy(methylsulfanyl)methyl]-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 102165634) has the molecular formula C14H21NO3S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-[methoxy(methylsulfanyl)methyl]-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-[methoxy(methylsulfanyl)methyl]-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 102165634 |
| Molecular Formula | C14H21NO3S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[methoxy(methylsulfanyl)methyl]-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | COC(SC)C1CCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H21NO3S2/c1-11-6-8-12(9-7-11)20(16,17)15-10-4-5-13(15)14(18-2)19-3/h6-9,13-14H,4-5,10H2,1-3H3 |
| InChIKey | BGSHRDDDSWJWQN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|