C12H17IO4 — CID 102165669
methyl (1S,3aR,6aR)-1-[(1S)-1-iodopropyl]-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate (PubChem CID 102165669) has the molecular formula C12H17IO4 and a molecular weight of 352.17 g/mol. Its IUPAC name is methyl (1S,3aR,6aR)-1-[(1S)-1-iodopropyl]-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate.
| Compound Name | methyl (1S,3aR,6aR)-1-[(1S)-1-iodopropyl]-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 102165669 |
| Molecular Formula | C12H17IO4 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | methyl (1S,3aR,6aR)-1-[(1S)-1-iodopropyl]-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
| SMILES | CC[C@H](I)[C@H]1OC(=O)[C@]2(C(=O)OC)CCC[C@@H]12 |
| InChI | InChI=1S/C12H17IO4/c1-3-8(13)9-7-5-4-6-12(7,10(14)16-2)11(15)17-9/h7-9H,3-6H2,1-2H3/t7-,8-,9-,12+/m0/s1 |
| InChIKey | AUCUFKOKMPWTPM-PHGLEFOZSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|