C25H29F2N3O — CID 10216574
(E,2R,3S)-6-(4-tert-butylphenyl)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol (PubChem CID 10216574) has the molecular formula C25H29F2N3O and a molecular weight of 425.52 g/mol. Its IUPAC name is (E,2R,3S)-6-(4-tert-butylphenyl)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol.
| Compound Name | (E,2R,3S)-6-(4-tert-butylphenyl)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 10216574 |
| Molecular Formula | C25H29F2N3O |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | (E,2R,3S)-6-(4-tert-butylphenyl)-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
| SMILES | C[C@@H](C/C=C/c1ccc(C(C)(C)C)cc1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H29F2N3O/c1-18(6-5-7-19-8-10-20(11-9-19)24(2,3)4)25(31,15-30-17-28-16-29-30)22-13-12-21(26)14-23(22)27/h5,7-14,16-18,31H,6,15H2,1-4H3/b7-5+/t18-,25+/m0/s1 |
| InChIKey | SOYRPNAMABEDGZ-VJJZONIDSA-N |
| XLogP | 5.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |