C18H16N2S3 — CID 102165882
4,5-bis(2,5-dimethylthiophen-3-yl)-2,1,3-benzothiadiazole (PubChem CID 102165882) has the molecular formula C18H16N2S3 and a molecular weight of 356.54 g/mol. Its IUPAC name is 4,5-bis(2,5-dimethylthiophen-3-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 102165882 |
| Molecular Formula | C18H16N2S3 |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-2,1,3-benzothiadiazole |
| SMILES | Cc1cc(-c2ccc3nsnc3c2-c2cc(C)sc2C)c(C)s1 |
| InChI | InChI=1S/C18H16N2S3/c1-9-7-14(11(3)21-9)13-5-6-16-18(20-23-19-16)17(13)15-8-10(2)22-12(15)4/h5-8H,1-4H3 |
| InChIKey | SROWRZPXMGWCHT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |