C23H20Cl2N2O2 — CID 10216595
4,5-bis(4-chlorophenyl)-2-(3,4-dimethoxyphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 10216595) has the molecular formula C23H20Cl2N2O2 and a molecular weight of 427.33 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-(3,4-dimethoxyphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 4,5-bis(4-chlorophenyl)-2-(3,4-dimethoxyphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 10216595 |
| Molecular Formula | C23H20Cl2N2O2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-(3,4-dimethoxyphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | COc1ccc(C2=NC(c3ccc(Cl)cc3)C(c3ccc(Cl)cc3)N2)cc1OC |
| InChI | InChI=1S/C23H20Cl2N2O2/c1-28-19-12-7-16(13-20(19)29-2)23-26-21(14-3-8-17(24)9-4-14)22(27-23)15-5-10-18(25)11-6-15/h3-13,21-22H,1-2H3,(H,26,27) |
| InChIKey | BRERTGWXHUVSQZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |