C21H36O7Si — CID 10216625
(12E,17E)-14-[tert-butyl(dimethyl)silyl]oxy-1,4,7,10-tetraoxacyclononadeca-12,17-diene-11,19-dione (PubChem CID 10216625) has the molecular formula C21H36O7Si and a molecular weight of 428.60 g/mol. Its IUPAC name is (12E,17E)-14-[tert-butyl(dimethyl)silyl]oxy-1,4,7,10-tetraoxacyclononadeca-12,17-diene-11,19-dione.
| Compound Name | (12E,17E)-14-[tert-butyl(dimethyl)silyl]oxy-1,4,7,10-tetraoxacyclononadeca-12,17-diene-11,19-dione |
|---|---|
| PubChem CID | 10216625 |
| Molecular Formula | C21H36O7Si |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (12E,17E)-14-[tert-butyl(dimethyl)silyl]oxy-1,4,7,10-tetraoxacyclononadeca-12,17-diene-11,19-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC1/C=C/C(=O)OCCOCCOCCOC(=O)/C=C/CC1 |
| InChI | InChI=1S/C21H36O7Si/c1-21(2,3)29(4,5)28-18-8-6-7-9-19(22)26-16-14-24-12-13-25-15-17-27-20(23)11-10-18/h7,9-11,18H,6,8,12-17H2,1-5H3/b9-7+,11-10+ |
| InChIKey | CBXHPXFOSGVIFP-RJECPTDASA-N |
| XLogP | 3.40 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|