C20H26N4O4 — CID 102166787
(7S,9aR)-7-methyl-2-(2-morpholin-4-yl-2-oxo-1-phenylethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 102166787) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is (7S,9aR)-7-methyl-2-(2-morpholin-4-yl-2-oxo-1-phenylethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-methyl-2-(2-morpholin-4-yl-2-oxo-1-phenylethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 102166787 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (7S,9aR)-7-methyl-2-(2-morpholin-4-yl-2-oxo-1-phenylethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | C[C@@H]1NC(=O)[C@H]2CN(C(C(=O)N3CCOCC3)c3ccccc3)CCN2C1=O |
| InChI | InChI=1S/C20H26N4O4/c1-14-19(26)24-8-7-23(13-16(24)18(25)21-14)17(15-5-3-2-4-6-15)20(27)22-9-11-28-12-10-22/h2-6,14,16-17H,7-13H2,1H3,(H,21,25)/t14-,16+,17?/m0/s1 |
| InChIKey | AZXIPIUFNOQELM-NOYLFRNESA-N |
| XLogP | -0.38 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |