C29H58F2O4Si2 — CID 102166928
(2Z,7R,8R,9R,10S,12E)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-difluoro-9-methoxy-8,10-dimethyltetradeca-2,12-dien-5-ol (PubChem CID 102166928) has the molecular formula C29H58F2O4Si2 and a molecular weight of 564.95 g/mol. Its IUPAC name is (2Z,7R,8R,9R,10S,12E)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-difluoro-9-methoxy-8,10-dimethyltetradeca-2,12-dien-5-ol.
| Compound Name | (2Z,7R,8R,9R,10S,12E)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-difluoro-9-methoxy-8,10-dimethyltetradeca-2,12-dien-5-ol |
|---|---|
| PubChem CID | 102166928 |
| Molecular Formula | C29H58F2O4Si2 |
| Molecular Weight | 564.95 g/mol |
| Exact Mass | 564.38 |
| IUPAC Name | (2Z,7R,8R,9R,10S,12E)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4-difluoro-9-methoxy-8,10-dimethyltetradeca-2,12-dien-5-ol |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](CC(O)C(F)(F)/C=C\CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H58F2O4Si2/c1-15-16-18-22(2)26(33-10)23(3)24(35-37(13,14)28(7,8)9)21-25(32)29(30,31)19-17-20-34-36(11,12)27(4,5)6/h15-17,19,22-26,32H,18,20-21H2,1-14H3/b16-15+,19-17-/t22-,23-,24+,25?,26+/m0/s1 |
| InChIKey | FMIMGRJRNSCZFK-JHYZHVMDSA-N |
| XLogP | 8.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.95 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|