C23H40F2O4Si — CID 102166930
(2R)-2-[(E,2R,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3,3-difluoro-2H-pyran-6-one (PubChem CID 102166930) has the molecular formula C23H40F2O4Si and a molecular weight of 446.65 g/mol. Its IUPAC name is (2R)-2-[(E,2R,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3,3-difluoro-2H-pyran-6-one.
| Compound Name | (2R)-2-[(E,2R,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3,3-difluoro-2H-pyran-6-one |
|---|---|
| PubChem CID | 102166930 |
| Molecular Formula | C23H40F2O4Si |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2R)-2-[(E,2R,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3,3-difluoro-2H-pyran-6-one |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@H](C)[C@@H](C[C@H]1OC(=O)C=CC1(F)F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40F2O4Si/c1-10-11-12-16(2)21(27-7)17(3)18(29-30(8,9)22(4,5)6)15-19-23(24,25)14-13-20(26)28-19/h10-11,13-14,16-19,21H,12,15H2,1-9H3/b11-10+/t16-,17+,18+,19+,21+/m0/s1 |
| InChIKey | ISBIJEFEZHVITC-FQUBSSJBSA-N |
| XLogP | 6.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|