C7H8O4 — CID 102167162
(3aS,6S,6aR)-6-methyl-3,3a,6,6a-tetrahydrofuro[3,4-b]furan-2,4-dione (PubChem CID 102167162) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is (3aS,6S,6aR)-6-methyl-3,3a,6,6a-tetrahydrofuro[3,4-b]furan-2,4-dione.
| Compound Name | (3aS,6S,6aR)-6-methyl-3,3a,6,6a-tetrahydrofuro[3,4-b]furan-2,4-dione |
|---|---|
| PubChem CID | 102167162 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (3aS,6S,6aR)-6-methyl-3,3a,6,6a-tetrahydrofuro[3,4-b]furan-2,4-dione |
| SMILES | C[C@@H]1OC(=O)[C@H]2CC(=O)O[C@@H]12 |
| InChI | InChI=1S/C7H8O4/c1-3-6-4(7(9)10-3)2-5(8)11-6/h3-4,6H,2H2,1H3/t3-,4-,6-/m0/s1 |
| InChIKey | BGGXTDWYJPJISI-FKZODXBYSA-N |
| XLogP | -0.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |