C28H23F3N2O5S — CID 102167226
methyl 2-methyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate (PubChem CID 102167226) has the molecular formula C28H23F3N2O5S and a molecular weight of 556.56 g/mol. Its IUPAC name is methyl 2-methyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate.
| Compound Name | methyl 2-methyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 102167226 |
| Molecular Formula | C28H23F3N2O5S |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | methyl 2-methyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate |
| SMILES | COC(=O)C1CN(C)S(=O)(=O)c2c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C28H23F3N2O5S/c1-32-16-23(27(35)38-2)33-24(34)15-20(13-18-9-5-8-17-7-3-4-12-22(17)18)25(26(33)39(32,36)37)19-10-6-11-21(14-19)28(29,30)31/h3-12,14-15,23H,13,16H2,1-2H3 |
| InChIKey | TZUYYCAEKZBPFS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |