C27H21F3N2O5S — CID 102167230
methyl 8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate (PubChem CID 102167230) has the molecular formula C27H21F3N2O5S and a molecular weight of 542.54 g/mol. Its IUPAC name is methyl 8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate.
| Compound Name | methyl 8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 102167230 |
| Molecular Formula | C27H21F3N2O5S |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | methyl 8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate |
| SMILES | COC(=O)C1CNS(=O)(=O)c2c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C27H21F3N2O5S/c1-37-26(34)22-15-31-38(35,36)25-24(18-9-5-10-20(13-18)27(28,29)30)19(14-23(33)32(22)25)12-17-8-4-7-16-6-2-3-11-21(16)17/h2-11,13-14,22,31H,12,15H2,1H3 |
| InChIKey | MXNHCGJBEKCHAE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |