C25H23F3N4 — CID 10216740
N-(4-tert-butylphenyl)-2-methyl-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine (PubChem CID 10216740) has the molecular formula C25H23F3N4 and a molecular weight of 436.48 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-methyl-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine.
| Compound Name | N-(4-tert-butylphenyl)-2-methyl-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 10216740 |
| Molecular Formula | C25H23F3N4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-methyl-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine |
| SMILES | Cc1nc(Nc2ccc(C(C)(C)C)cc2)c2ccc(-c3ncccc3C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C25H23F3N4/c1-15-30-21-14-16(22-20(25(26,27)28)6-5-13-29-22)7-12-19(21)23(31-15)32-18-10-8-17(9-11-18)24(2,3)4/h5-14H,1-4H3,(H,30,31,32) |
| InChIKey | BNBIXRPBVDXRBK-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |