C30H38O4S2 — CID 102167487
(2R,3R,4S)-5,5-bis(ethylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-ol (PubChem CID 102167487) has the molecular formula C30H38O4S2 and a molecular weight of 526.76 g/mol. Its IUPAC name is (2R,3R,4S)-5,5-bis(ethylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-ol.
| Compound Name | (2R,3R,4S)-5,5-bis(ethylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
|---|---|
| PubChem CID | 102167487 |
| Molecular Formula | C30H38O4S2 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (2R,3R,4S)-5,5-bis(ethylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-ol |
| SMILES | CCSC(SCC)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C30H38O4S2/c1-3-35-30(36-4-2)29(34-22-26-18-12-7-13-19-26)28(33-21-25-16-10-6-11-17-25)27(31)23-32-20-24-14-8-5-9-15-24/h5-19,27-31H,3-4,20-23H2,1-2H3/t27-,28-,29+/m1/s1 |
| InChIKey | GBBOIIARQIWBCH-NLDZOOGBSA-N |
| XLogP | 6.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|