About [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane
[(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane (PubChem CID 102168063) has the molecular formula C12H23BO2
and a molecular weight of 210.13 g/mol. Its IUPAC name is [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane.
Molecular Properties
| Compound Name | [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane |
| PubChem CID | 102168063 |
| Molecular Formula | C12H23BO2 |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane |
| SMILES | C=CC/C(C)=C/B(OC(C)C)OC(C)C |
| InChI | InChI=1S/C12H23BO2/c1-7-8-12(6)9-13(14-10(2)3)15-11(4)5/h7,9-11H,1,8H2,2-6H3/b12-9+ |
| InChIKey | MAOQNISQCKZQAR-FMIVXFBMSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane?
The IUPAC name of [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane (CID 102168063) is [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane.
What is the SMILES notation for [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane?
The canonical SMILES for [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane is C=CC/C(C)=C/B(OC(C)C)OC(C)C.
What is the InChIKey of [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane?
The InChIKey is MAOQNISQCKZQAR-FMIVXFBMSA-N. The full InChI is InChI=1S/C12H23BO2/c1-7-8-12(6)9-13(14-10(2)3)15-11(4)5/h7,9-11H,1,8H2,2-6H3/b12-9+.
What are the key properties of [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane?
[(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane has a molecular weight of 210.13 g/mol, XLogP of 3.39, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-2-methylpenta-1,4-dienyl]-di(propan-2-yloxy)borane is sourced from PubChem (CID 102168063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).