About 2-cyanoethyl N-phenylcarbamodithioate
2-cyanoethyl N-phenylcarbamodithioate (PubChem CID 102168178) has the molecular formula C10H10N2S2
and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-cyanoethyl N-phenylcarbamodithioate.
Molecular Properties
| Compound Name | 2-cyanoethyl N-phenylcarbamodithioate |
| PubChem CID | 102168178 |
| Molecular Formula | C10H10N2S2 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2-cyanoethyl N-phenylcarbamodithioate |
| SMILES | N#CCCSC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C10H10N2S2/c11-7-4-8-14-10(13)12-9-5-2-1-3-6-9/h1-3,5-6H,4,8H2,(H,12,13) |
| InChIKey | DUAQWRLFGCHVLJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl N-phenylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl N-phenylcarbamodithioate?
The IUPAC name of 2-cyanoethyl N-phenylcarbamodithioate (CID 102168178) is 2-cyanoethyl N-phenylcarbamodithioate.
What is the SMILES notation for 2-cyanoethyl N-phenylcarbamodithioate?
The canonical SMILES for 2-cyanoethyl N-phenylcarbamodithioate is N#CCCSC(=S)Nc1ccccc1.
What is the InChIKey of 2-cyanoethyl N-phenylcarbamodithioate?
The InChIKey is DUAQWRLFGCHVLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S2/c11-7-4-8-14-10(13)12-9-5-2-1-3-6-9/h1-3,5-6H,4,8H2,(H,12,13).
What are the key properties of 2-cyanoethyl N-phenylcarbamodithioate?
2-cyanoethyl N-phenylcarbamodithioate has a molecular weight of 222.34 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl N-phenylcarbamodithioate is sourced from PubChem (CID 102168178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).