C19H24O4 — CID 102168235
(1S,2S,9S,11R)-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-6,10-dione (PubChem CID 102168235) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (1S,2S,9S,11R)-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-6,10-dione.
| Compound Name | (1S,2S,9S,11R)-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-6,10-dione |
|---|---|
| PubChem CID | 102168235 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1S,2S,9S,11R)-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-6,10-dione |
| SMILES | CC(C)=CC[C@@]12OC(C)(C)[C@@H]3C[C@@H](C=C4C(=O)CCO[C@]431)C2=O |
| InChI | InChI=1S/C19H24O4/c1-11(2)5-7-18-16(21)12-9-13-14(20)6-8-22-19(13,18)15(10-12)17(3,4)23-18/h5,9,12,15H,6-8,10H2,1-4H3/t12-,15+,18+,19-/m1/s1 |
| InChIKey | PTEGOVNASYRXFW-NHAHKUSKSA-N |
| XLogP | 2.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|